C11H18O — CID 88900517
(2Z,4Z,6E)-6-(methoxymethyl)nona-2,4,6-triene (PubChem CID 88900517) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2Z,4Z,6E)-6-(methoxymethyl)nona-2,4,6-triene.
| Compound Name | (2Z,4Z,6E)-6-(methoxymethyl)nona-2,4,6-triene |
|---|---|
| PubChem CID | 88900517 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2Z,4Z,6E)-6-(methoxymethyl)nona-2,4,6-triene |
| SMILES | C/C=C\C=C/C(=C\CC)COC |
| InChI | InChI=1S/C11H18O/c1-4-6-7-9-11(8-5-2)10-12-3/h4,6-9H,5,10H2,1-3H3/b6-4-,9-7-,11-8+ |
| InChIKey | GENIOBJAPQEVKR-CPZMXRHXSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|