C37H28F2O4S — CID 88900539
[2,2-difluoro-2-[(4-methylphenyl)-diphenylmethyl]sulfonylethyl] anthracene-9-carboxylate (PubChem CID 88900539) has the molecular formula C37H28F2O4S and a molecular weight of 606.69 g/mol. Its IUPAC name is [2,2-difluoro-2-[(4-methylphenyl)-diphenylmethyl]sulfonylethyl] anthracene-9-carboxylate.
| Compound Name | [2,2-difluoro-2-[(4-methylphenyl)-diphenylmethyl]sulfonylethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 88900539 |
| Molecular Formula | C37H28F2O4S |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | [2,2-difluoro-2-[(4-methylphenyl)-diphenylmethyl]sulfonylethyl] anthracene-9-carboxylate |
| SMILES | Cc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)c2c3ccccc3cc3ccccc23)cc1 |
| InChI | InChI=1S/C37H28F2O4S/c1-26-20-22-31(23-21-26)37(29-14-4-2-5-15-29,30-16-6-3-7-17-30)44(41,42)36(38,39)25-43-35(40)34-32-18-10-8-12-27(32)24-28-13-9-11-19-33(28)34/h2-24H,25H2,1H3 |
| InChIKey | PQKJCONUXOWMCY-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|