C18H27NO4 — CID 88900836
(E)-3-[2-methoxy-5-(methylperoxymethyl)phenyl]-N,N-di(propan-2-yl)prop-2-enamide (PubChem CID 88900836) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-3-[2-methoxy-5-(methylperoxymethyl)phenyl]-N,N-di(propan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-methoxy-5-(methylperoxymethyl)phenyl]-N,N-di(propan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 88900836 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (E)-3-[2-methoxy-5-(methylperoxymethyl)phenyl]-N,N-di(propan-2-yl)prop-2-enamide |
| SMILES | COOCc1ccc(OC)c(/C=C/C(=O)N(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C18H27NO4/c1-13(2)19(14(3)4)18(20)10-8-16-11-15(12-23-22-6)7-9-17(16)21-5/h7-11,13-14H,12H2,1-6H3/b10-8+ |
| InChIKey | PFMDKYYIYNVQES-CSKARUKUSA-N |
| XLogP | 3.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|