C29H34F6N4O3 — CID 88901354
4-[(3S,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(butoxymethyl)-6-phenylpiperidin-3-yl]-1H-1,2,4-triazol-5-one (PubChem CID 88901354) has the molecular formula C29H34F6N4O3 and a molecular weight of 600.60 g/mol. Its IUPAC name is 4-[(3S,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(butoxymethyl)-6-phenylpiperidin-3-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[(3S,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(butoxymethyl)-6-phenylpiperidin-3-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 88901354 |
| Molecular Formula | C29H34F6N4O3 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 4-[(3S,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(butoxymethyl)-6-phenylpiperidin-3-yl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCCOC[C@]1(n2cn[nH]c2=O)CC[C@@](CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)NC1 |
| InChI | InChI=1S/C29H34F6N4O3/c1-3-4-12-41-17-26(39-19-37-38-25(39)40)10-11-27(36-16-26,22-8-6-5-7-9-22)18-42-20(2)21-13-23(28(30,31)32)15-24(14-21)29(33,34)35/h5-9,13-15,19-20,36H,3-4,10-12,16-18H2,1-2H3,(H,38,40)/t20-,26+,27-/m1/s1 |
| InChIKey | DPMFLEDSSQBYLG-JAMKYWPSSA-N |
| XLogP | 6.18 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|