C15H22N2O4 — CID 88901883
methyl N-[(2S)-1-[(2S,5S)-2-formyl-5-prop-2-enylpyrrolidin-1-yl]-1-oxopent-4-en-2-yl]carbamate (PubChem CID 88901883) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S,5S)-2-formyl-5-prop-2-enylpyrrolidin-1-yl]-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S,5S)-2-formyl-5-prop-2-enylpyrrolidin-1-yl]-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 88901883 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | methyl N-[(2S)-1-[(2S,5S)-2-formyl-5-prop-2-enylpyrrolidin-1-yl]-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=CC[C@@H]1CC[C@@H](C=O)N1C(=O)[C@H](CC=C)NC(=O)OC |
| InChI | InChI=1S/C15H22N2O4/c1-4-6-11-8-9-12(10-18)17(11)14(19)13(7-5-2)16-15(20)21-3/h4-5,10-13H,1-2,6-9H2,3H3,(H,16,20)/t11-,12+,13+/m1/s1 |
| InChIKey | KQGONKSLIRSBRB-AGIUHOORSA-N |
| XLogP | 1.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|