C13H21N5O3 — CID 8890216
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(tetrazol-1-yl)acetate (PubChem CID 8890216) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(tetrazol-1-yl)acetate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(tetrazol-1-yl)acetate |
|---|---|
| PubChem CID | 8890216 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(tetrazol-1-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cn1cnnn1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C13H21N5O3/c1-10(21-12(19)8-18-9-14-16-17-18)13(20)15-11-6-4-2-3-5-7-11/h9-11H,2-8H2,1H3,(H,15,20)/t10-/m1/s1 |
| InChIKey | TTWDSFZXSIPQRH-SNVBAGLBSA-N |
| XLogP | 0.44 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |