C26H25BClF2N5O — CID 88907586
CID 88907586 (PubChem CID 88907586) has the molecular formula C26H25BClF2N5O and a molecular weight of 507.78 g/mol.
| Compound Name | CID 88907586 |
|---|---|
| PubChem CID | 88907586 |
| Molecular Formula | C26H25BClF2N5O |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | — |
| SMILES | [B]N1CCC[C@@H](Cn2c(-c3ccc(OC)cc3Cl)cc3cnc(NCc4ccc(F)c(F)c4)nc32)C1 |
| InChI | InChI=1S/C26H25BClF2N5O/c1-36-19-5-6-20(21(28)11-19)24-10-18-13-32-26(31-12-16-4-7-22(29)23(30)9-16)33-25(18)35(24)15-17-3-2-8-34(27)14-17/h4-7,9-11,13,17H,2-3,8,12,14-15H2,1H3,(H,31,32,33)/t17-/m1/s1 |
| InChIKey | MGGMMPOBXDPRKM-QGZVFWFLSA-N |
| XLogP | 5.45 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|