C11H16FN3O2S — CID 88908561
2-ethyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide (PubChem CID 88908561) has the molecular formula C11H16FN3O2S and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-ethyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide.
| Compound Name | 2-ethyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 88908561 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-ethyl-4-fluoro-N-methoxy-N-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxamide |
| SMILES | CCc1nc2c(s1)CCN(C(=O)N(C)OC)C2F |
| InChI | InChI=1S/C11H16FN3O2S/c1-4-8-13-9-7(18-8)5-6-15(10(9)12)11(16)14(2)17-3/h10H,4-6H2,1-3H3 |
| InChIKey | BUKFWOLIICKRAP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|