C15H11NO5S — CID 88908779
1-(benzenesulfonyl)-5,6-dihydroxyindole-3-carbaldehyde (PubChem CID 88908779) has the molecular formula C15H11NO5S and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5,6-dihydroxyindole-3-carbaldehyde.
| Compound Name | 1-(benzenesulfonyl)-5,6-dihydroxyindole-3-carbaldehyde |
|---|---|
| PubChem CID | 88908779 |
| Molecular Formula | C15H11NO5S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 1-(benzenesulfonyl)-5,6-dihydroxyindole-3-carbaldehyde |
| SMILES | O=Cc1cn(S(=O)(=O)c2ccccc2)c2cc(O)c(O)cc12 |
| InChI | InChI=1S/C15H11NO5S/c17-9-10-8-16(13-7-15(19)14(18)6-12(10)13)22(20,21)11-4-2-1-3-5-11/h1-9,18-19H |
| InChIKey | HARLJQZGRFZUMO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|