C18H13NO6S — CID 5328691
9-(benzenesulfonyl)carbazole-1,2,6,7-tetrol (PubChem CID 5328691) has the molecular formula C18H13NO6S and a molecular weight of 371.37 g/mol. Its IUPAC name is 9-(benzenesulfonyl)carbazole-1,2,6,7-tetrol.
| Compound Name | 9-(benzenesulfonyl)carbazole-1,2,6,7-tetrol |
|---|---|
| PubChem CID | 5328691 |
| Molecular Formula | C18H13NO6S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 9-(benzenesulfonyl)carbazole-1,2,6,7-tetrol |
| SMILES | O=S(=O)(c1ccccc1)n1c2cc(O)c(O)cc2c2ccc(O)c(O)c21 |
| InChI | InChI=1S/C18H13NO6S/c20-14-7-6-11-12-8-15(21)16(22)9-13(12)19(17(11)18(14)23)26(24,25)10-4-2-1-3-5-10/h1-9,20-23H |
| InChIKey | KLGNLOILGBXFQG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|