C21H14ClNO5S — CID 142635493
1-(benzenesulfonyl)-2-(2-chlorophenyl)-6,7-dihydroxyquinolin-4-one (PubChem CID 142635493) has the molecular formula C21H14ClNO5S and a molecular weight of 427.87 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(2-chlorophenyl)-6,7-dihydroxyquinolin-4-one.
| Compound Name | 1-(benzenesulfonyl)-2-(2-chlorophenyl)-6,7-dihydroxyquinolin-4-one |
|---|---|
| PubChem CID | 142635493 |
| Molecular Formula | C21H14ClNO5S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(2-chlorophenyl)-6,7-dihydroxyquinolin-4-one |
| SMILES | O=c1cc(-c2ccccc2Cl)n(S(=O)(=O)c2ccccc2)c2cc(O)c(O)cc12 |
| InChI | InChI=1S/C21H14ClNO5S/c22-16-9-5-4-8-14(16)17-11-19(24)15-10-20(25)21(26)12-18(15)23(17)29(27,28)13-6-2-1-3-7-13/h1-12,25-26H |
| InChIKey | ILANYBBHJUANMH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|