C16H12F2N2O5S — CID 174242673
[1-(benzenesulfonyl)-4,5-difluoro-6-hydroxyindol-2-yl]methyl carbamate (PubChem CID 174242673) has the molecular formula C16H12F2N2O5S and a molecular weight of 382.34 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-4,5-difluoro-6-hydroxyindol-2-yl]methyl carbamate.
| Compound Name | [1-(benzenesulfonyl)-4,5-difluoro-6-hydroxyindol-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 174242673 |
| Molecular Formula | C16H12F2N2O5S |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [1-(benzenesulfonyl)-4,5-difluoro-6-hydroxyindol-2-yl]methyl carbamate |
| SMILES | NC(=O)OCc1cc2c(F)c(F)c(O)cc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H12F2N2O5S/c17-14-11-6-9(8-25-16(19)22)20(12(11)7-13(21)15(14)18)26(23,24)10-4-2-1-3-5-10/h1-7,21H,8H2,(H2,19,22) |
| InChIKey | PPCSCORCXQOPDU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |