C31H50O4 — CID 88910021
(1S,4aR,4bS,6aS,9R,10S)-1,4a,4b,9,10-pentamethyl-1-(3-methylperoxypropyl)-2-prop-1-en-2-yl-2,3,4,5,6,7,8,9,10,10a,12,12a-dodecahydrochrysene-6a-carboxylic acid (PubChem CID 88910021) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is (1S,4aR,4bS,6aS,9R,10S)-1,4a,4b,9,10-pentamethyl-1-(3-methylperoxypropyl)-2-prop-1-en-2-yl-2,3,4,5,6,7,8,9,10,10a,12,12a-dodecahydrochrysene-6a-carboxylic acid.
| Compound Name | (1S,4aR,4bS,6aS,9R,10S)-1,4a,4b,9,10-pentamethyl-1-(3-methylperoxypropyl)-2-prop-1-en-2-yl-2,3,4,5,6,7,8,9,10,10a,12,12a-dodecahydrochrysene-6a-carboxylic acid |
|---|---|
| PubChem CID | 88910021 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (1S,4aR,4bS,6aS,9R,10S)-1,4a,4b,9,10-pentamethyl-1-(3-methylperoxypropyl)-2-prop-1-en-2-yl-2,3,4,5,6,7,8,9,10,10a,12,12a-dodecahydrochrysene-6a-carboxylic acid |
| SMILES | C=C(C)C1CC[C@]2(C)C(CC=C3C4[C@@H](C)[C@H](C)CC[C@]4(C(=O)O)CC[C@]32C)[C@@]1(C)CCCOOC |
| InChI | InChI=1S/C31H50O4/c1-20(2)23-13-15-30(7)25(28(23,5)14-9-19-35-34-8)11-10-24-26-22(4)21(3)12-16-31(26,27(32)33)18-17-29(24,30)6/h10,21-23,25-26H,1,9,11-19H2,2-8H3,(H,32,33)/t21-,22+,23?,25?,26?,28+,29-,30-,31+/m1/s1 |
| InChIKey | JUMGXSQLDYKGDC-ZGJMRBMOSA-N |
| XLogP | 7.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|