C23H32N4O5S — CID 88910546
tert-butyl (2S)-2-[2-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-2-oxoethyl]pyrrolidine-1-carboxylate (PubChem CID 88910546) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-2-oxoethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-2-oxoethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88910546 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | tert-butyl (2S)-2-[2-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylcarbonylhydrazinyl]-2-oxoethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CC(=O)NNC(=O)SCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H32N4O5S/c1-23(2,3)32-22(31)26-12-7-10-17(26)14-19(28)24-25-21(30)33-15-20(29)27-13-6-9-16-8-4-5-11-18(16)27/h4-5,8,11,17H,6-7,9-10,12-15H2,1-3H3,(H,24,28)(H,25,30)/t17-/m0/s1 |
| InChIKey | ARMTUFZJDYVDMA-KRWDZBQOSA-N |
| XLogP | 3.23 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|