C10H8N2O4 — CID 88910633
methyl (E)-3-(3,4-dinitrosophenyl)prop-2-enoate (PubChem CID 88910633) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is methyl (E)-3-(3,4-dinitrosophenyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(3,4-dinitrosophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 88910633 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | methyl (E)-3-(3,4-dinitrosophenyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N=O)c(N=O)c1 |
| InChI | InChI=1S/C10H8N2O4/c1-16-10(13)5-3-7-2-4-8(11-14)9(6-7)12-15/h2-6H,1H3/b5-3+ |
| InChIKey | AZVQQWAAXNGMPM-HWKANZROSA-N |
| XLogP | 2.67 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|