About ethyl 5-ethoxy-2,4-dioxopentanoate
ethyl 5-ethoxy-2,4-dioxopentanoate (PubChem CID 88913008) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is ethyl 5-ethoxy-2,4-dioxopentanoate.
Molecular Properties
| Compound Name | ethyl 5-ethoxy-2,4-dioxopentanoate |
| PubChem CID | 88913008 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | ethyl 5-ethoxy-2,4-dioxopentanoate |
| SMILES | CCOCC(=O)CC(=O)C(=O)OCC |
| InChI | InChI=1S/C9H14O5/c1-3-13-6-7(10)5-8(11)9(12)14-4-2/h3-6H2,1-2H3 |
| InChIKey | GTSTWJLCOIWYRG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-ethoxy-2,4-dioxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-ethoxy-2,4-dioxopentanoate?
The IUPAC name of ethyl 5-ethoxy-2,4-dioxopentanoate (CID 88913008) is ethyl 5-ethoxy-2,4-dioxopentanoate.
What is the SMILES notation for ethyl 5-ethoxy-2,4-dioxopentanoate?
The canonical SMILES for ethyl 5-ethoxy-2,4-dioxopentanoate is CCOCC(=O)CC(=O)C(=O)OCC.
What is the InChIKey of ethyl 5-ethoxy-2,4-dioxopentanoate?
The InChIKey is GTSTWJLCOIWYRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5/c1-3-13-6-7(10)5-8(11)9(12)14-4-2/h3-6H2,1-2H3.
What are the key properties of ethyl 5-ethoxy-2,4-dioxopentanoate?
ethyl 5-ethoxy-2,4-dioxopentanoate has a molecular weight of 202.21 g/mol, XLogP of 0.11, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-ethoxy-2,4-dioxopentanoate is sourced from PubChem (CID 88913008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).