C19H16BN3O4 — CID 88913723
CID 88913723 (PubChem CID 88913723) has the molecular formula C19H16BN3O4 and a molecular weight of 361.17 g/mol.
| Compound Name | CID 88913723 |
|---|---|
| PubChem CID | 88913723 |
| Molecular Formula | C19H16BN3O4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Cn2c(=O)n(CCC(=O)O)c3ccccc32)c2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C19H16BN3O4/c20-12-7-11(13-9-17(24)21-14(13)8-12)10-23-16-4-2-1-3-15(16)22(19(23)27)6-5-18(25)26/h1-4,7-8H,5-6,9-10H2,(H,21,24)(H,25,26) |
| InChIKey | LJLDAVHWGSZKPV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|