C12H11ClN2O3S2 — CID 8891626
6-(3-chloro-4-methoxyphenyl)-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazine 2,2-dioxide (PubChem CID 8891626) has the molecular formula C12H11ClN2O3S2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 6-(3-chloro-4-methoxyphenyl)-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazine 2,2-dioxide.
| Compound Name | 6-(3-chloro-4-methoxyphenyl)-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazine 2,2-dioxide |
|---|---|
| PubChem CID | 8891626 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 6-(3-chloro-4-methoxyphenyl)-3,4-dihydro-[1,3]thiazolo[2,3-c][1,2,4]thiadiazine 2,2-dioxide |
| SMILES | COc1ccc(C2=CSC3=NS(=O)(=O)CCN23)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O3S2/c1-18-11-3-2-8(6-9(11)13)10-7-19-12-14-20(16,17)5-4-15(10)12/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | AMZQBBKAACWOGJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |