C27H37NO4 — CID 88919510
methyl (3aR,4S,7aR)-2-ethynyl-4-octanoyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 88919510) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is methyl (3aR,4S,7aR)-2-ethynyl-4-octanoyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | methyl (3aR,4S,7aR)-2-ethynyl-4-octanoyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 88919510 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | methyl (3aR,4S,7aR)-2-ethynyl-4-octanoyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | C#CC1C[C@H]2[C@@H](OC(=O)CCCCCCC)CCC[C@H]2N1C(=O)OC.Cc1cc2ccc1-2 |
| InChI | InChI=1S/C20H31NO4.C7H6/c1-4-6-7-8-9-13-19(22)25-18-12-10-11-17-16(18)14-15(5-2)21(17)20(23)24-3;1-5-4-6-2-3-7(5)6/h2,15-18H,4,6-14H2,1,3H3;2-4H,1H3/t15?,16-,17-,18+;/m1./s1 |
| InChIKey | INQUWOLRYLHVNZ-XELRPJGGSA-N |
| XLogP | 5.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|