C27H34N2O5 — CID 88919473
methyl (3aR,4S,7aR)-2-ethynyl-4-(4-oxo-4-pyrrolidin-1-ylbutanoyl)oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 88919473) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is methyl (3aR,4S,7aR)-2-ethynyl-4-(4-oxo-4-pyrrolidin-1-ylbutanoyl)oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | methyl (3aR,4S,7aR)-2-ethynyl-4-(4-oxo-4-pyrrolidin-1-ylbutanoyl)oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 88919473 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | methyl (3aR,4S,7aR)-2-ethynyl-4-(4-oxo-4-pyrrolidin-1-ylbutanoyl)oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate;2-methylbicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | C#CC1C[C@H]2[C@@H](OC(=O)CCC(=O)N3CCCC3)CCC[C@H]2N1C(=O)OC.Cc1cc2ccc1-2 |
| InChI | InChI=1S/C20H28N2O5.C7H6/c1-3-14-13-15-16(22(14)20(25)26-2)7-6-8-17(15)27-19(24)10-9-18(23)21-11-4-5-12-21;1-5-4-6-2-3-7(5)6/h1,14-17H,4-13H2,2H3;2-4H,1H3/t14?,15-,16-,17+;/m1./s1 |
| InChIKey | ZHXYDBXJCHXNLW-NETGTVSGSA-N |
| XLogP | 3.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|