C17H22ClF2N3O3 — CID 88921967
tert-butyl (2R,3S,4R)-4-amino-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-fluoropyrrolidine-1-carboxylate (PubChem CID 88921967) has the molecular formula C17H22ClF2N3O3 and a molecular weight of 389.83 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-4-amino-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-4-amino-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88921967 |
| Molecular Formula | C17H22ClF2N3O3 |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | tert-butyl (2R,3S,4R)-4-amino-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-3-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](N)[C@H](F)[C@H]1C(=O)N(F)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H22ClF2N3O3/c1-17(2,3)26-16(25)22-9-12(21)13(19)14(22)15(24)23(20)8-10-5-4-6-11(18)7-10/h4-7,12-14H,8-9,21H2,1-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | XQOPSULWBZZGGW-RDBSUJKOSA-N |
| XLogP | 2.84 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|