C19H23ClF2N2O5 — CID 88922109
tert-butyl (2S,3S,4S)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-4-fluoro-3-(2-oxoethoxy)pyrrolidine-1-carboxylate (PubChem CID 88922109) has the molecular formula C19H23ClF2N2O5 and a molecular weight of 432.85 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-4-fluoro-3-(2-oxoethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-4-fluoro-3-(2-oxoethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88922109 |
| Molecular Formula | C19H23ClF2N2O5 |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | tert-butyl (2S,3S,4S)-2-[(3-chlorophenyl)methyl-fluorocarbamoyl]-4-fluoro-3-(2-oxoethoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](F)[C@@H](OCC=O)[C@H]1C(=O)N(F)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClF2N2O5/c1-19(2,3)29-18(27)23-11-14(21)16(28-8-7-25)15(23)17(26)24(22)10-12-5-4-6-13(20)9-12/h4-7,9,14-16H,8,10-11H2,1-3H3/t14-,15-,16+/m0/s1 |
| InChIKey | INPSNUMQZUNHJE-HRCADAONSA-N |
| XLogP | 3.09 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|