C20H14Cl3F3N2O3 — CID 88924409
methyl 6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate (PubChem CID 88924409) has the molecular formula C20H14Cl3F3N2O3 and a molecular weight of 493.70 g/mol. Its IUPAC name is methyl 6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 88924409 |
| Molecular Formula | C20H14Cl3F3N2O3 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | methyl 6-methyl-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1cc2cc(C(=O)NC(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)[nH]c2cc1C |
| InChI | InChI=1S/C20H14Cl3F3N2O3/c1-8-3-14-9(4-11(8)19(30)31-2)7-15(27-14)18(29)28-17(20(24,25)26)10-5-12(21)16(23)13(22)6-10/h3-7,17,27H,1-2H3,(H,28,29) |
| InChIKey | UTCNSMMKUPVPLS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|