C20H13Cl4F3N2O3 — CID 90072181
ethyl 6-chloro-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate (PubChem CID 90072181) has the molecular formula C20H13Cl4F3N2O3 and a molecular weight of 528.14 g/mol. Its IUPAC name is ethyl 6-chloro-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate.
| Compound Name | ethyl 6-chloro-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 90072181 |
| Molecular Formula | C20H13Cl4F3N2O3 |
| Molecular Weight | 528.14 g/mol |
| Exact Mass | 525.96 |
| IUPAC Name | ethyl 6-chloro-2-[[2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethyl]carbamoyl]-1H-indole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C(=O)NC(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)[nH]c2cc1Cl |
| InChI | InChI=1S/C20H13Cl4F3N2O3/c1-2-32-19(31)10-3-8-6-15(28-14(8)7-11(10)21)18(30)29-17(20(25,26)27)9-4-12(22)16(24)13(23)5-9/h3-7,17,28H,2H2,1H3,(H,29,30) |
| InChIKey | PGIFAWVLYAQOJP-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.14 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|