C17H15AsF2N3O2S — CID 88925076
CID 88925076 (PubChem CID 88925076) has the molecular formula C17H15AsF2N3O2S and a molecular weight of 438.31 g/mol.
| Compound Name | CID 88925076 |
|---|---|
| PubChem CID | 88925076 |
| Molecular Formula | C17H15AsF2N3O2S |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | — |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c([As]c2ccc3ncncc3c2)c1F |
| InChI | InChI=1S/C17H15AsF2N3O2S/c1-2-7-26(24,25)23-15-6-4-13(19)16(17(15)20)18-12-3-5-14-11(8-12)9-21-10-22-14/h3-6,8-10,23H,2,7H2,1H3 |
| InChIKey | QBQDGSFFHDHIRQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|