C14H17F2N7O3S — CID 50997527
1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(6-hydrazinylpyrimidin-4-yl)urea (PubChem CID 50997527) has the molecular formula C14H17F2N7O3S and a molecular weight of 401.40 g/mol. Its IUPAC name is 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(6-hydrazinylpyrimidin-4-yl)urea.
| Compound Name | 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(6-hydrazinylpyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 50997527 |
| Molecular Formula | C14H17F2N7O3S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(6-hydrazinylpyrimidin-4-yl)urea |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(NC(=O)Nc2cc(NN)ncn2)c1F |
| InChI | InChI=1S/C14H17F2N7O3S/c1-2-5-27(25,26)23-9-4-3-8(15)13(12(9)16)21-14(24)20-10-6-11(22-17)19-7-18-10/h3-4,6-7,23H,2,5,17H2,1H3,(H3,18,19,20,21,22,24) |
| InChIKey | HYTVFSOLGHEHJF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|