C30H43NO2S — CID 88929342
(1S,3Z)-3-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[5-(phenylsulfonimidoyl)pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 88929342) has the molecular formula C30H43NO2S and a molecular weight of 481.75 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[5-(phenylsulfonimidoyl)pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[5-(phenylsulfonimidoyl)pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 88929342 |
| Molecular Formula | C30H43NO2S |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[5-(phenylsulfonimidoyl)pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | [H]N=S(=O)(CCCC(C)C1CC[C@H]2/C(=C/C=C3/C[C@@H](O)CCC3=C)CCC[C@]12C)c1ccccc1 |
| InChI | InChI=1S/C30H43NO2S/c1-22-13-16-26(32)21-25(22)15-14-24-10-7-19-30(3)28(17-18-29(24)30)23(2)9-8-20-34(31,33)27-11-5-4-6-12-27/h4-6,11-12,14-15,23,26,28-29,31-32H,1,7-10,13,16-21H2,2-3H3/b24-14+,25-15-/t23?,26-,28?,29-,30+,34?/m0/s1 |
| InChIKey | SUJWUSMPVNEHST-GTXVKXATSA-N |
| XLogP | 7.68 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |