C17H21N3O — CID 88929436
(1-amino-5-azatetracyclo[6.3.1.03,10.04,6]dodecan-5-yl)-pyridin-2-ylmethanone (PubChem CID 88929436) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is (1-amino-5-azatetracyclo[6.3.1.03,10.04,6]dodecan-5-yl)-pyridin-2-ylmethanone.
| Compound Name | (1-amino-5-azatetracyclo[6.3.1.03,10.04,6]dodecan-5-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 88929436 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (1-amino-5-azatetracyclo[6.3.1.03,10.04,6]dodecan-5-yl)-pyridin-2-ylmethanone |
| SMILES | NC12CC3CC(C1)C(C2)C1C(C3)N1C(=O)c1ccccn1 |
| InChI | InChI=1S/C17H21N3O/c18-17-7-10-5-11(8-17)12(9-17)15-14(6-10)20(15)16(21)13-3-1-2-4-19-13/h1-4,10-12,14-15H,5-9,18H2 |
| InChIKey | SJDVBFIIACKETP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|