C20H27BN4O6 — CID 88930147
CID 88930147 (PubChem CID 88930147) has the molecular formula C20H27BN4O6 and a molecular weight of 430.27 g/mol.
| Compound Name | CID 88930147 |
|---|---|
| PubChem CID | 88930147 |
| Molecular Formula | C20H27BN4O6 |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)C2CC3(CN2C(=O)[C@@H](NC(=O)OC)C(C)C)OCCO3)c(N)c1 |
| InChI | InChI=1S/C20H27BN4O6/c1-11(2)16(24-19(28)29-3)18(27)25-10-20(30-6-7-31-20)9-15(25)17(26)23-14-5-4-12(21)8-13(14)22/h4-5,8,11,15-16H,6-7,9-10,22H2,1-3H3,(H,23,26)(H,24,28)/t15?,16-/m0/s1 |
| InChIKey | VWWSOUZASCUBIL-LYKKTTPLSA-N |
| XLogP | -0.27 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|