C11H18N4O4 — CID 88930272
N-(1-acetamidoethyl)-2-(3-amino-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 88930272) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(1-acetamidoethyl)-2-(3-amino-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-(1-acetamidoethyl)-2-(3-amino-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 88930272 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-(1-acetamidoethyl)-2-(3-amino-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CC(=O)NC(C)NC(=O)C(C)N1C(=O)CC(N)C1=O |
| InChI | InChI=1S/C11H18N4O4/c1-5(10(18)14-6(2)13-7(3)16)15-9(17)4-8(12)11(15)19/h5-6,8H,4,12H2,1-3H3,(H,13,16)(H,14,18) |
| InChIKey | LESLQBKTXDAPLG-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|