About 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate
2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate (PubChem CID 88931085) has the molecular formula C27H52N2O7
and a molecular weight of 516.72 g/mol. Its IUPAC name is 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate.
Molecular Properties
| Compound Name | 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate |
| PubChem CID | 88931085 |
| Molecular Formula | C27H52N2O7 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate |
| SMILES | CCCCC(CC)CC(=O)OCCN(CCO)C(=O)CCCCCCCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C27H52N2O7/c1-3-5-12-24(4-2)23-27(35)36-22-18-29(17-21-32)26(34)14-11-9-7-6-8-10-13-25(33)28(15-19-30)16-20-31/h24,30-32H,3-23H2,1-2H3 |
| InChIKey | AGJUSTXUHWNLRV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate?
The IUPAC name of 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate (CID 88931085) is 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate.
What is the SMILES notation for 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate?
The canonical SMILES for 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate is CCCCC(CC)CC(=O)OCCN(CCO)C(=O)CCCCCCCCC(=O)N(CCO)CCO.
What is the InChIKey of 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate?
The InChIKey is AGJUSTXUHWNLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H52N2O7/c1-3-5-12-24(4-2)23-27(35)36-22-18-29(17-21-32)26(34)14-11-9-7-6-8-10-13-25(33)28(15-19-30)16-20-31/h24,30-32H,3-23H2,1-2H3.
What are the key properties of 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate?
2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate has a molecular weight of 516.72 g/mol, XLogP of 2.89, 24 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[10-[bis(2-hydroxyethyl)amino]-10-oxodecanoyl]-(2-hydroxyethyl)amino]ethyl 3-ethylheptanoate is sourced from PubChem (CID 88931085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).