C11H18N4OS — CID 88932091
S-tert-butyl 2-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbothioate (PubChem CID 88932091) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is S-tert-butyl 2-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbothioate.
| Compound Name | S-tert-butyl 2-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbothioate |
|---|---|
| PubChem CID | 88932091 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | S-tert-butyl 2-amino-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbothioate |
| SMILES | CC(C)(C)SC(=O)N1CCn2nc(N)cc2C1 |
| InChI | InChI=1S/C11H18N4OS/c1-11(2,3)17-10(16)14-4-5-15-8(7-14)6-9(12)13-15/h6H,4-5,7H2,1-3H3,(H2,12,13) |
| InChIKey | IJBVYSKBMPHYPF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|