About methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate
methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate (PubChem CID 88933353) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate.
Analyze methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate?
The IUPAC name of methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate (CID 88933353) is methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate.
What is the SMILES notation for methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate?
The canonical SMILES for methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate is CCC(C)(C)C(CC)(CC(C)C)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate?
The InChIKey is PLZFFIKZHYQXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-8-13(5,6)14(9-2,10-11(3)4)12(15)16-7/h11H,8-10H2,1-7H3.
What are the key properties of methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate?
methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate has a molecular weight of 228.38 g/mol, XLogP of 4.04, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-3,3-dimethyl-2-(2-methylpropyl)pentanoate is sourced from PubChem (CID 88933353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).