C17H9BrS2 — CID 88934784
3-bromo-11-methyl-4,12-dithiapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1(17),2,5,7,9(18),10,13,15-octaene (PubChem CID 88934784) has the molecular formula C17H9BrS2 and a molecular weight of 357.30 g/mol. Its IUPAC name is 3-bromo-11-methyl-4,12-dithiapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1(17),2,5,7,9(18),10,13,15-octaene.
| Compound Name | 3-bromo-11-methyl-4,12-dithiapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1(17),2,5,7,9(18),10,13,15-octaene |
|---|---|
| PubChem CID | 88934784 |
| Molecular Formula | C17H9BrS2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 3-bromo-11-methyl-4,12-dithiapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1(17),2,5,7,9(18),10,13,15-octaene |
| SMILES | Cc1sc2cccc3c4c(Br)sc5cccc(c1c23)c54 |
| InChI | InChI=1S/C17H9BrS2/c1-8-13-9-4-2-7-12-15(9)16(17(18)20-12)10-5-3-6-11(19-8)14(10)13/h2-7H,1H3 |
| InChIKey | BMWOTCXHPXGQQY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|