C13H24BrNO2 — CID 88935019
3-bromo-N,N-bis(2-prop-2-enoxyethyl)propan-1-amine (PubChem CID 88935019) has the molecular formula C13H24BrNO2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 3-bromo-N,N-bis(2-prop-2-enoxyethyl)propan-1-amine.
| Compound Name | 3-bromo-N,N-bis(2-prop-2-enoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 88935019 |
| Molecular Formula | C13H24BrNO2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-bromo-N,N-bis(2-prop-2-enoxyethyl)propan-1-amine |
| SMILES | C=CCOCCN(CCCBr)CCOCC=C |
| InChI | InChI=1S/C13H24BrNO2/c1-3-10-16-12-8-15(7-5-6-14)9-13-17-11-4-2/h3-4H,1-2,5-13H2 |
| InChIKey | KJXVATPHBIHVDR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|