About N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide
N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide (PubChem CID 88935471) has the molecular formula C24H26FN3O4
and a molecular weight of 439.49 g/mol. Its IUPAC name is N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide |
| PubChem CID | 88935471 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide |
| SMILES | CC(C)C(CC(=O)N1c2ccccc2Nc2ccccc21)C(=O)NC(CC=O)C(=O)CF |
| InChI | InChI=1S/C24H26FN3O4/c1-15(2)16(24(32)27-19(11-12-29)22(30)14-25)13-23(31)28-20-9-5-3-7-17(20)26-18-8-4-6-10-21(18)28/h3-10,12,15-16,19,26H,11,13-14H2,1-2H3,(H,27,32) |
| InChIKey | AMNRWNSUWXPRPE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide?
The IUPAC name of N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide (CID 88935471) is N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide.
What is the SMILES notation for N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide?
The canonical SMILES for N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide is CC(C)C(CC(=O)N1c2ccccc2Nc2ccccc21)C(=O)NC(CC=O)C(=O)CF.
What is the InChIKey of N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide?
The InChIKey is AMNRWNSUWXPRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26FN3O4/c1-15(2)16(24(32)27-19(11-12-29)22(30)14-25)13-23(31)28-20-9-5-3-7-17(20)26-18-8-4-6-10-21(18)28/h3-10,12,15-16,19,26H,11,13-14H2,1-2H3,(H,27,32).
What are the key properties of N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide?
N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide has a molecular weight of 439.49 g/mol, XLogP of 3.68, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide is sourced from PubChem (CID 88935471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).