C24H26FN3O4 — CID 88935471
N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide (PubChem CID 88935471) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide.
| Compound Name | N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 88935471 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-(1-fluoro-2,5-dioxopentan-3-yl)-4-oxo-4-(10H-phenazin-5-yl)-2-propan-2-ylbutanamide |
| SMILES | CC(C)C(CC(=O)N1c2ccccc2Nc2ccccc21)C(=O)NC(CC=O)C(=O)CF |
| InChI | InChI=1S/C24H26FN3O4/c1-15(2)16(24(32)27-19(11-12-29)22(30)14-25)13-23(31)28-20-9-5-3-7-17(20)26-18-8-4-6-10-21(18)28/h3-10,12,15-16,19,26H,11,13-14H2,1-2H3,(H,27,32) |
| InChIKey | AMNRWNSUWXPRPE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|