C9H18N2O5 — CID 88936523
N,4-dihydroxy-4-(4-hydroxybutanoylamino)-N-methylbutanamide (PubChem CID 88936523) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is N,4-dihydroxy-4-(4-hydroxybutanoylamino)-N-methylbutanamide.
| Compound Name | N,4-dihydroxy-4-(4-hydroxybutanoylamino)-N-methylbutanamide |
|---|---|
| PubChem CID | 88936523 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N,4-dihydroxy-4-(4-hydroxybutanoylamino)-N-methylbutanamide |
| SMILES | CN(O)C(=O)CCC(O)NC(=O)CCCO |
| InChI | InChI=1S/C9H18N2O5/c1-11(16)9(15)5-4-8(14)10-7(13)3-2-6-12/h8,12,14,16H,2-6H2,1H3,(H,10,13) |
| InChIKey | FRWNRLFRILZSLP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|