C9H20N2O3 — CID 90749374
5-amino-N-(1,4-dihydroxybutyl)pentanamide (PubChem CID 90749374) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-amino-N-(1,4-dihydroxybutyl)pentanamide.
| Compound Name | 5-amino-N-(1,4-dihydroxybutyl)pentanamide |
|---|---|
| PubChem CID | 90749374 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 5-amino-N-(1,4-dihydroxybutyl)pentanamide |
| SMILES | NCCCCC(=O)NC(O)CCCO |
| InChI | InChI=1S/C9H20N2O3/c10-6-2-1-4-8(13)11-9(14)5-3-7-12/h9,12,14H,1-7,10H2,(H,11,13) |
| InChIKey | JTGYQYZXCLXMNP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|