C23H17BN2O5 — CID 88937378
CID 88937378 (PubChem CID 88937378) has the molecular formula C23H17BN2O5 and a molecular weight of 412.21 g/mol.
| Compound Name | CID 88937378 |
|---|---|
| PubChem CID | 88937378 |
| Molecular Formula | C23H17BN2O5 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(OCC(=O)O)c(-c2noc(-c3ccc(-c4ccc(OC)cc4)cc3)n2)c1 |
| InChI | InChI=1S/C23H17BN2O5/c1-29-18-9-6-15(7-10-18)14-2-4-16(5-3-14)23-25-22(26-31-23)19-12-17(24)8-11-20(19)30-13-21(27)28/h2-12H,13H2,1H3,(H,27,28) |
| InChIKey | BOKBSLMUATVHMS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|