About acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine
acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine (PubChem CID 88937716) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine.
Molecular Properties
| Compound Name | acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine |
| PubChem CID | 88937716 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine |
| SMILES | CC=O.NCCc1cnc[nH]1.c1c[nH]cn1 |
| InChI | InChI=1S/C5H9N3.C3H4N2.C2H4O/c6-2-1-5-3-7-4-8-5;1-2-5-3-4-1;1-2-3/h3-4H,1-2,6H2,(H,7,8);1-3H,(H,4,5);2H,1H3 |
| InChIKey | JVBXUHDOBCDALN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine?
The IUPAC name of acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine (CID 88937716) is acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine.
What is the SMILES notation for acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine?
The canonical SMILES for acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine is CC=O.NCCc1cnc[nH]1.c1c[nH]cn1.
What is the InChIKey of acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine?
The InChIKey is JVBXUHDOBCDALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.C3H4N2.C2H4O/c6-2-1-5-3-7-4-8-5;1-2-5-3-4-1;1-2-3/h3-4H,1-2,6H2,(H,7,8);1-3H,(H,4,5);2H,1H3.
What are the key properties of acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine?
acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine has a molecular weight of 223.28 g/mol, XLogP of 0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1H-imidazole;2-(1H-imidazol-5-yl)ethanamine is sourced from PubChem (CID 88937716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).