C18H22Cl2N4OS — CID 8893863
2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 8893863) has the molecular formula C18H22Cl2N4OS and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 8893863 |
| Molecular Formula | C18H22Cl2N4OS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2C(=O)CSc2nnc3c(Cl)cc(Cl)cn23)C1 |
| InChI | InChI=1S/C18H22Cl2N4OS/c1-17(2)5-12-6-18(3,9-17)10-24(12)14(25)8-26-16-22-21-15-13(20)4-11(19)7-23(15)16/h4,7,12H,5-6,8-10H2,1-3H3/t12-,18-/m0/s1 |
| InChIKey | LSXPEPGBDZECDM-SGTLLEGYSA-N |
| XLogP | 4.56 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |