About 2-methylprop-2-enyl 4-(methylamino)butanoate
2-methylprop-2-enyl 4-(methylamino)butanoate (PubChem CID 88938843) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-methylprop-2-enyl 4-(methylamino)butanoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl 4-(methylamino)butanoate |
| PubChem CID | 88938843 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-methylprop-2-enyl 4-(methylamino)butanoate |
| SMILES | C=C(C)COC(=O)CCCNC |
| InChI | InChI=1S/C9H17NO2/c1-8(2)7-12-9(11)5-4-6-10-3/h10H,1,4-7H2,2-3H3 |
| InChIKey | MBEOUPHRCMLYTJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl 4-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl 4-(methylamino)butanoate?
The IUPAC name of 2-methylprop-2-enyl 4-(methylamino)butanoate (CID 88938843) is 2-methylprop-2-enyl 4-(methylamino)butanoate.
What is the SMILES notation for 2-methylprop-2-enyl 4-(methylamino)butanoate?
The canonical SMILES for 2-methylprop-2-enyl 4-(methylamino)butanoate is C=C(C)COC(=O)CCCNC.
What is the InChIKey of 2-methylprop-2-enyl 4-(methylamino)butanoate?
The InChIKey is MBEOUPHRCMLYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-8(2)7-12-9(11)5-4-6-10-3/h10H,1,4-7H2,2-3H3.
What are the key properties of 2-methylprop-2-enyl 4-(methylamino)butanoate?
2-methylprop-2-enyl 4-(methylamino)butanoate has a molecular weight of 171.24 g/mol, XLogP of 1.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl 4-(methylamino)butanoate is sourced from PubChem (CID 88938843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).