C13H19IN2O — CID 88940035
(2R)-2-(iodoamino)-3-methyl-N-[(1S)-1-phenylethyl]butanamide (PubChem CID 88940035) has the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. Its IUPAC name is (2R)-2-(iodoamino)-3-methyl-N-[(1S)-1-phenylethyl]butanamide.
| Compound Name | (2R)-2-(iodoamino)-3-methyl-N-[(1S)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 88940035 |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (2R)-2-(iodoamino)-3-methyl-N-[(1S)-1-phenylethyl]butanamide |
| SMILES | CC(C)[C@@H](NI)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C13H19IN2O/c1-9(2)12(16-14)13(17)15-10(3)11-7-5-4-6-8-11/h4-10,12,16H,1-3H3,(H,15,17)/t10-,12+/m0/s1 |
| InChIKey | HDKHBLNYXNEDTK-CMPLNLGQSA-N |
| XLogP | 2.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|