C14H30N4O3 — CID 88940247
ethyl 3,4-bis(4-aminobutylamino)-4-oxobutanoate (PubChem CID 88940247) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is ethyl 3,4-bis(4-aminobutylamino)-4-oxobutanoate.
| Compound Name | ethyl 3,4-bis(4-aminobutylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 88940247 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | ethyl 3,4-bis(4-aminobutylamino)-4-oxobutanoate |
| SMILES | CCOC(=O)CC(NCCCCN)C(=O)NCCCCN |
| InChI | InChI=1S/C14H30N4O3/c1-2-21-13(19)11-12(17-9-5-3-7-15)14(20)18-10-6-4-8-16/h12,17H,2-11,15-16H2,1H3,(H,18,20) |
| InChIKey | ULFQGDPKZQHUDB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|