C8H12O — CID 88944494
(2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol (PubChem CID 88944494) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol.
| Compound Name | (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 88944494 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol |
| SMILES | C=C/C=C\C(=C/C)CO |
| InChI | InChI=1S/C8H12O/c1-3-5-6-8(4-2)7-9/h3-6,9H,1,7H2,2H3/b6-5-,8-4+ |
| InChIKey | CPCFLEUCFVLOOZ-QNMAEOQASA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|