About (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol
(2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol (PubChem CID 88944494) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol |
| PubChem CID | 88944494 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol |
| SMILES | C=C/C=C\C(=C/C)CO |
| InChI | InChI=1S/C8H12O/c1-3-5-6-8(4-2)7-9/h3-6,9H,1,7H2,2H3/b6-5-,8-4+ |
| InChIKey | CPCFLEUCFVLOOZ-QNMAEOQASA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol?
The IUPAC name of (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol (CID 88944494) is (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol.
What is the SMILES notation for (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol?
The canonical SMILES for (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol is C=C/C=C\C(=C/C)CO.
What is the InChIKey of (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol?
The InChIKey is CPCFLEUCFVLOOZ-QNMAEOQASA-N. The full InChI is InChI=1S/C8H12O/c1-3-5-6-8(4-2)7-9/h3-6,9H,1,7H2,2H3/b6-5-,8-4+.
What are the key properties of (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol?
(2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol has a molecular weight of 124.18 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2-ethylidenehexa-3,5-dien-1-ol is sourced from PubChem (CID 88944494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).