C23H29FO6S — CID 88944892
(3R,4R,5S)-2-[(2Z,4E)-3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoro-6-methoxyhepta-2,4,6-trienyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 88944892) has the molecular formula C23H29FO6S and a molecular weight of 452.54 g/mol. Its IUPAC name is (3R,4R,5S)-2-[(2Z,4E)-3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoro-6-methoxyhepta-2,4,6-trienyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S)-2-[(2Z,4E)-3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoro-6-methoxyhepta-2,4,6-trienyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 88944892 |
| Molecular Formula | C23H29FO6S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (3R,4R,5S)-2-[(2Z,4E)-3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoro-6-methoxyhepta-2,4,6-trienyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C(/C=C(F)\C(=C/CC1OC(CO)[C@@H](O)[C@H](O)[C@H]1O)CC1Cc2ccccc2S1)OC |
| InChI | InChI=1S/C23H29FO6S/c1-13(29-2)9-17(24)14(10-16-11-15-5-3-4-6-20(15)31-16)7-8-18-21(26)23(28)22(27)19(12-25)30-18/h3-7,9,16,18-19,21-23,25-28H,1,8,10-12H2,2H3/b14-7-,17-9+/t16?,18?,19?,21-,22+,23+/m0/s1 |
| InChIKey | AZWSFARHOLHRRW-RNTDBQNLSA-N |
| XLogP | 2.27 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|