C22H25FO6 — CID 170378958
(2S,3R,4R,5S,6R)-2-[(3Z,5E)-4-(1-benzofuran-2-ylmethyl)-5-fluorohepta-1,3,5-trien-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 170378958) has the molecular formula C22H25FO6 and a molecular weight of 404.43 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[(3Z,5E)-4-(1-benzofuran-2-ylmethyl)-5-fluorohepta-1,3,5-trien-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[(3Z,5E)-4-(1-benzofuran-2-ylmethyl)-5-fluorohepta-1,3,5-trien-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 170378958 |
| Molecular Formula | C22H25FO6 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[(3Z,5E)-4-(1-benzofuran-2-ylmethyl)-5-fluorohepta-1,3,5-trien-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C(/C=C(Cc1cc2ccccc2o1)\C(F)=C/C)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H25FO6/c1-3-16(23)14(10-15-9-13-6-4-5-7-17(13)28-15)8-12(2)22-21(27)20(26)19(25)18(11-24)29-22/h3-9,18-22,24-27H,2,10-11H2,1H3/b14-8-,16-3+/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | FYDBKBAWHCCPIY-OJHFWXIBSA-N |
| XLogP | 2.17 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|