C17H20O8 — CID 118707323
3-[[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxymethyl]chromen-2-one (PubChem CID 118707323) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is 3-[[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxymethyl]chromen-2-one.
| Compound Name | 3-[[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxymethyl]chromen-2-one |
|---|---|
| PubChem CID | 118707323 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]oxymethyl]chromen-2-one |
| SMILES | CO[C@H]1O[C@H](CO)[C@H](O)[C@H](OCc2cc3ccccc3oc2=O)[C@H]1O |
| InChI | InChI=1S/C17H20O8/c1-22-17-14(20)15(13(19)12(7-18)25-17)23-8-10-6-9-4-2-3-5-11(9)24-16(10)21/h2-6,12-15,17-20H,7-8H2,1H3/t12-,13+,14-,15+,17+/m1/s1 |
| InChIKey | SEGZMJNGWKYDDQ-NMNMXBMNSA-N |
| XLogP | -0.24 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|