C14H19ClO4 — CID 154202641
(3R,4R,5R)-4-[(2-chlorophenyl)methoxy]-5-ethyl-2-methoxyoxolan-3-ol (PubChem CID 154202641) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is (3R,4R,5R)-4-[(2-chlorophenyl)methoxy]-5-ethyl-2-methoxyoxolan-3-ol.
| Compound Name | (3R,4R,5R)-4-[(2-chlorophenyl)methoxy]-5-ethyl-2-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 154202641 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (3R,4R,5R)-4-[(2-chlorophenyl)methoxy]-5-ethyl-2-methoxyoxolan-3-ol |
| SMILES | CC[C@H]1OC(OC)[C@H](O)[C@H]1OCc1ccccc1Cl |
| InChI | InChI=1S/C14H19ClO4/c1-3-11-13(12(16)14(17-2)19-11)18-8-9-6-4-5-7-10(9)15/h4-7,11-14,16H,3,8H2,1-2H3/t11-,12-,13+,14?/m1/s1 |
| InChIKey | ZBVAWEWONCVLMX-HABKJSAYSA-N |
| XLogP | 2.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |