C22H24BrClO3 — CID 139703774
(2R,3S,3aS,9bR)-5-(bromomethyl)-3-[(2-chlorophenyl)methoxy]-2-ethyl-5-methyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromene (PubChem CID 139703774) has the molecular formula C22H24BrClO3 and a molecular weight of 451.79 g/mol. Its IUPAC name is (2R,3S,3aS,9bR)-5-(bromomethyl)-3-[(2-chlorophenyl)methoxy]-2-ethyl-5-methyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromene.
| Compound Name | (2R,3S,3aS,9bR)-5-(bromomethyl)-3-[(2-chlorophenyl)methoxy]-2-ethyl-5-methyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromene |
|---|---|
| PubChem CID | 139703774 |
| Molecular Formula | C22H24BrClO3 |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (2R,3S,3aS,9bR)-5-(bromomethyl)-3-[(2-chlorophenyl)methoxy]-2-ethyl-5-methyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromene |
| SMILES | CC[C@H]1O[C@@H]2c3ccccc3C(C)(CBr)O[C@@H]2[C@H]1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H24BrClO3/c1-3-18-20(25-12-14-8-4-7-11-17(14)24)21-19(26-18)15-9-5-6-10-16(15)22(2,13-23)27-21/h4-11,18-21H,3,12-13H2,1-2H3/t18-,19-,20+,21+,22?/m1/s1 |
| InChIKey | NRBSHSUTSFGDEW-RPKDUVEISA-N |
| XLogP | 5.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|